C10H19FO2 — CID 58241360
(4S,5R)-2-fluoro-6-(methoxymethyl)-3,4,5-trimethyloxane (PubChem CID 58241360) has the molecular formula C10H19FO2 and a molecular weight of 190.26 g/mol. Its IUPAC name is (4S,5R)-2-fluoro-6-(methoxymethyl)-3,4,5-trimethyloxane.
| Compound Name | (4S,5R)-2-fluoro-6-(methoxymethyl)-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 58241360 |
| Molecular Formula | C10H19FO2 |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (4S,5R)-2-fluoro-6-(methoxymethyl)-3,4,5-trimethyloxane |
| SMILES | COCC1OC(F)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C10H19FO2/c1-6-7(2)9(5-12-4)13-10(11)8(6)3/h6-10H,5H2,1-4H3/t6-,7+,8?,9?,10?/m0/s1 |
| InChIKey | HKFSDTWKCRIJEM-BLHFLBKCSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |