C10H18O3 — CID 58241370
(3R,4S,6R)-6-methoxy-3,4,5-trimethyloxane-2-carbaldehyde (PubChem CID 58241370) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3R,4S,6R)-6-methoxy-3,4,5-trimethyloxane-2-carbaldehyde.
| Compound Name | (3R,4S,6R)-6-methoxy-3,4,5-trimethyloxane-2-carbaldehyde |
|---|---|
| PubChem CID | 58241370 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3R,4S,6R)-6-methoxy-3,4,5-trimethyloxane-2-carbaldehyde |
| SMILES | CO[C@@H]1OC(C=O)[C@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C10H18O3/c1-6-7(2)9(5-11)13-10(12-4)8(6)3/h5-10H,1-4H3/t6-,7+,8?,9?,10+/m0/s1 |
| InChIKey | YMYVIQQEEZTPFQ-HAEBQSFCSA-N |
| XLogP | 1.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|