C10H19FO — CID 58241376
(3R,4S)-2-ethyl-6-fluoro-3,4,5-trimethyloxane (PubChem CID 58241376) has the molecular formula C10H19FO and a molecular weight of 174.26 g/mol. Its IUPAC name is (3R,4S)-2-ethyl-6-fluoro-3,4,5-trimethyloxane.
| Compound Name | (3R,4S)-2-ethyl-6-fluoro-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 58241376 |
| Molecular Formula | C10H19FO |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3R,4S)-2-ethyl-6-fluoro-3,4,5-trimethyloxane |
| SMILES | CCC1OC(F)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C10H19FO/c1-5-9-7(3)6(2)8(4)10(11)12-9/h6-10H,5H2,1-4H3/t6-,7+,8?,9?,10?/m0/s1 |
| InChIKey | SWRHZPLCRQMECN-BLHFLBKCSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |