C12H23FO2 — CID 58241383
(4S,5R)-2-fluoro-3,4,5-trimethyl-6-(propoxymethyl)oxane (PubChem CID 58241383) has the molecular formula C12H23FO2 and a molecular weight of 218.31 g/mol. Its IUPAC name is (4S,5R)-2-fluoro-3,4,5-trimethyl-6-(propoxymethyl)oxane.
| Compound Name | (4S,5R)-2-fluoro-3,4,5-trimethyl-6-(propoxymethyl)oxane |
|---|---|
| PubChem CID | 58241383 |
| Molecular Formula | C12H23FO2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (4S,5R)-2-fluoro-3,4,5-trimethyl-6-(propoxymethyl)oxane |
| SMILES | CCCOCC1OC(F)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C12H23FO2/c1-5-6-14-7-11-9(3)8(2)10(4)12(13)15-11/h8-12H,5-7H2,1-4H3/t8-,9+,10?,11?,12?/m0/s1 |
| InChIKey | CALYTKUXRMSYRA-WJZAEVBBSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|