C15H22O7 — CID 58241608
[(1S,2S,6S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate (PubChem CID 58241608) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is [(1S,2S,6S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,2S,6S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58241608 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(1S,2S,6S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@@H]1C(=O)O[C@H]2C1O[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H22O7/c1-6-14(2,3)13(17)20-9-7-8(18-11(9)16)10-12(19-7)22-15(4,5)21-10/h7-10,12H,6H2,1-5H3/t7?,8-,9-,10-,12-/m0/s1 |
| InChIKey | QFIQECJUPBUMOA-INBPEXDHSA-N |
| XLogP | 1.14 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |