C14H20O7 — CID 58241621
[(1S,2S,6S,8S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylbutanoate (PubChem CID 58241621) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(1S,2S,6S,8S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylbutanoate.
| Compound Name | [(1S,2S,6S,8S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58241621 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(1S,2S,6S,8S,9S)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@@H]1C(=O)O[C@@H]2[C@@H]3OC(C)(C)O[C@@H]3O[C@@H]21 |
| InChI | InChI=1S/C14H20O7/c1-5-6(2)11(15)18-9-7-8(17-12(9)16)10-13(19-7)21-14(3,4)20-10/h6-10,13H,5H2,1-4H3/t6?,7-,8-,9-,10-,13-/m0/s1 |
| InChIKey | YWRDMVRGKVWKNX-YUIXHCQQSA-N |
| XLogP | 0.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |