C8H12F6 — CID 58241625
1,1,1,4,4,4-hexafluoro-2,2,3,3-tetramethylbutane (PubChem CID 58241625) has the molecular formula C8H12F6 and a molecular weight of 222.17 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2,2,3,3-tetramethylbutane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 58241625 |
| Molecular Formula | C8H12F6 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2,2,3,3-tetramethylbutane |
| SMILES | CC(C)(C(F)(F)F)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C8H12F6/c1-5(2,7(9,10)11)6(3,4)8(12,13)14/h1-4H3 |
| InChIKey | KSOXAVACVUYOQW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |