C39H57F3O9 — CID 58241628
1-O-(1-methylcyclopentyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 3-O-[6-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 58241628) has the molecular formula C39H57F3O9 and a molecular weight of 726.87 g/mol. Its IUPAC name is 1-O-(1-methylcyclopentyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 3-O-[6-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(1-methylcyclopentyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 3-O-[6-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58241628 |
| Molecular Formula | C39H57F3O9 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | 1-O-(1-methylcyclopentyl) 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 3-O-[6-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1(C)CCCC1)C(=O)OC1CC2CC(CC(C)(O)C(F)(F)F)C1C2)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C39H57F3O9/c1-8-35(4,32(45)50-28-22-16-25-26(17-22)30(43)49-29(25)28)20-36(5,19-34(2,3)31(44)51-37(6)11-9-10-12-37)33(46)48-27-15-21-13-23(24(27)14-21)18-38(7,47)39(40,41)42/h21-29,47H,8-20H2,1-7H3 |
| InChIKey | CXEUEVVSHDUORW-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|