C16H32O2Si — CID 58241880
(E,1S)-1-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]but-2-en-1-ol (PubChem CID 58241880) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (E,1S)-1-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]but-2-en-1-ol.
| Compound Name | (E,1S)-1-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]but-2-en-1-ol |
|---|---|
| PubChem CID | 58241880 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (E,1S)-1-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]but-2-en-1-ol |
| SMILES | C/C=C/[C@H](O)[C@@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-7-10-14(17)13-11-8-9-12-15(13)18-19(5,6)16(2,3)4/h7,10,13-15,17H,8-9,11-12H2,1-6H3/b10-7+/t13-,14-,15-/m0/s1 |
| InChIKey | XGNAIRLAOVRDBS-ZIUOVVLSSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|