About 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol
2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol (PubChem CID 58241918) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol.
Molecular Properties
| Compound Name | 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol |
| PubChem CID | 58241918 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol |
| SMILES | CCC1=Cc2c(cccc2OCCO)CC1 |
| InChI | InChI=1S/C14H18O2/c1-2-11-6-7-12-4-3-5-14(13(12)10-11)16-9-8-15/h3-5,10,15H,2,6-9H2,1H3 |
| InChIKey | QAPIAPCCKVWCBN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol?
The IUPAC name of 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol (CID 58241918) is 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol.
What is the SMILES notation for 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol?
The canonical SMILES for 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol is CCC1=Cc2c(cccc2OCCO)CC1.
What is the InChIKey of 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol?
The InChIKey is QAPIAPCCKVWCBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-11-6-7-12-4-3-5-14(13(12)10-11)16-9-8-15/h3-5,10,15H,2,6-9H2,1H3.
What are the key properties of 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol?
2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol has a molecular weight of 218.30 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-ethyl-5,6-dihydronaphthalen-1-yl)oxy]ethanol is sourced from PubChem (CID 58241918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).