C15H24O2 — CID 58242057
2-[2-[(3S)-3-methylhexyl]phenoxy]ethanol (PubChem CID 58242057) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-[2-[(3S)-3-methylhexyl]phenoxy]ethanol.
| Compound Name | 2-[2-[(3S)-3-methylhexyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 58242057 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-[2-[(3S)-3-methylhexyl]phenoxy]ethanol |
| SMILES | CCC[C@H](C)CCc1ccccc1OCCO |
| InChI | InChI=1S/C15H24O2/c1-3-6-13(2)9-10-14-7-4-5-8-15(14)17-12-11-16/h4-5,7-8,13,16H,3,6,9-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | UXAYCGVGUYCSHA-ZDUSSCGKSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |