About [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol
[7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol (PubChem CID 58242256) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol.
Molecular Properties
| Compound Name | [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol |
| PubChem CID | 58242256 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol |
| SMILES | CC/C=C/c1cccc2c1OC(CO)C2 |
| InChI | InChI=1S/C13H16O2/c1-2-3-5-10-6-4-7-11-8-12(9-14)15-13(10)11/h3-7,12,14H,2,8-9H2,1H3/b5-3+ |
| InChIKey | ZFJCGZXLLGIFQQ-HWKANZROSA-N |
| XLogP | 2.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol?
The IUPAC name of [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol (CID 58242256) is [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol.
What is the SMILES notation for [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol?
The canonical SMILES for [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol is CC/C=C/c1cccc2c1OC(CO)C2.
What is the InChIKey of [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol?
The InChIKey is ZFJCGZXLLGIFQQ-HWKANZROSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-3-5-10-6-4-7-11-8-12(9-14)15-13(10)11/h3-7,12,14H,2,8-9H2,1H3/b5-3+.
What are the key properties of [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol?
[7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol has a molecular weight of 204.27 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [7-[(E)-but-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]methanol is sourced from PubChem (CID 58242256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).