C27H35Cl3N4O9 — CID 58242339
[(3R,4R)-3-[(2S,4R,5S)-3-acetyloxy-5,6-dimethyl-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 58242339) has the molecular formula C27H35Cl3N4O9 and a molecular weight of 665.96 g/mol. Its IUPAC name is [(3R,4R)-3-[(2S,4R,5S)-3-acetyloxy-5,6-dimethyl-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R)-3-[(2S,4R,5S)-3-acetyloxy-5,6-dimethyl-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58242339 |
| Molecular Formula | C27H35Cl3N4O9 |
| Molecular Weight | 665.96 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | [(3R,4R)-3-[(2S,4R,5S)-3-acetyloxy-5,6-dimethyl-4-phenylmethoxyoxan-2-yl]oxy-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1OC(COC(C)=O)[C@H](O[C@@H]2OC(C)[C@H](C)[C@@H](OCc3ccccc3)C2OC(C)=O)[C@H](C)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H35Cl3N4O9/c1-13-15(3)39-25(23(40-17(5)36)22(13)38-11-18-9-7-6-8-10-18)42-21-14(2)20(33-34-32)24(43-26(31)27(28,29)30)41-19(21)12-37-16(4)35/h6-10,13-15,19-25,31H,11-12H2,1-5H3/b31-26+/t13-,14+,15?,19?,20?,21+,22+,23?,24?,25-/m0/s1 |
| InChIKey | LMKDNOOGAGKIFW-PLXRXDHDSA-N |
| XLogP | 5.24 |
| TPSA | 171.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.96 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|