C15H24O6 — CID 58242445
[(3aR,6R,7S)-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] 4-oxopentanoate (PubChem CID 58242445) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(3aR,6R,7S)-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] 4-oxopentanoate.
| Compound Name | [(3aR,6R,7S)-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 58242445 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(3aR,6R,7S)-2,2,5,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@H]1C(C)O[C@@H]2OC(C)(C)OC2[C@H]1C |
| InChI | InChI=1S/C15H24O6/c1-8(16)6-7-11(17)19-12-9(2)13-14(18-10(12)3)21-15(4,5)20-13/h9-10,12-14H,6-7H2,1-5H3/t9-,10?,12+,13?,14+/m0/s1 |
| InChIKey | DDYFTJOVBRFIJK-UFWIVVTHSA-N |
| XLogP | 1.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |