C16H36O5Si3 — CID 58242501
(3R,4S,5R,6R)-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-one (PubChem CID 58242501) has the molecular formula C16H36O5Si3 and a molecular weight of 392.72 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-one |
|---|---|
| PubChem CID | 58242501 |
| Molecular Formula | C16H36O5Si3 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (3R,4S,5R,6R)-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O5Si3/c1-11-12-13(19-22(2,3)4)14(20-23(5,6)7)15(16(17)18-12)21-24(8,9)10/h12-15H,11H2,1-10H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | OVOYHAMRYFEGNK-APIJFGDWSA-N |
| XLogP | 3.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|