C30H32FNO7S — CID 58242593
[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-ethyl-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-3-yl] acetate (PubChem CID 58242593) has the molecular formula C30H32FNO7S and a molecular weight of 569.65 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-ethyl-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-ethyl-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 58242593 |
| Molecular Formula | C30H32FNO7S |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-ethyl-6-[3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]oxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(-c4ccc(F)nc4)s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H32FNO7S/c1-6-24-28(36-17(3)33)30(38-19(5)35)29(37-18(4)34)27(39-24)20-8-7-16(2)22(13-20)14-23-10-11-25(40-23)21-9-12-26(31)32-15-21/h7-13,15,24,27-30H,6,14H2,1-5H3/t24-,27+,28-,29+,30+/m1/s1 |
| InChIKey | DYVGUNPUZFNKPO-AZTRSOTFSA-N |
| XLogP | 5.49 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|