C43H42O4S — CID 58242607
(3S,4S,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)phenyl]-6-ethyl-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 58242607) has the molecular formula C43H42O4S and a molecular weight of 654.87 g/mol. Its IUPAC name is (3S,4S,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)phenyl]-6-ethyl-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (3S,4S,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)phenyl]-6-ethyl-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 58242607 |
| Molecular Formula | C43H42O4S |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | (3S,4S,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)phenyl]-6-ethyl-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CC[C@H]1OC(c2cccc(Cc3cc4ccccc4s3)c2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H42O4S/c1-2-38-41(44-28-31-15-6-3-7-16-31)43(46-30-33-19-10-5-11-20-33)42(45-29-32-17-8-4-9-18-32)40(47-38)36-23-14-21-34(25-36)26-37-27-35-22-12-13-24-39(35)48-37/h3-25,27,38,40-43H,2,26,28-30H2,1H3/t38-,40?,41-,42+,43+/m1/s1 |
| InChIKey | LLKDBCLIJWBOTL-SUNNYAOGSA-N |
| XLogP | 10.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |