About 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine
2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine (PubChem CID 58242650) has the molecular formula C19H19NOS
and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine.
Molecular Properties
| Compound Name | 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine |
| PubChem CID | 58242650 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine |
| SMILES | COc1cccc(-c2ccc(Cc3cc(C)ccc3C)s2)n1 |
| InChI | InChI=1S/C19H19NOS/c1-13-7-8-14(2)15(11-13)12-16-9-10-18(22-16)17-5-4-6-19(20-17)21-3/h4-11H,12H2,1-3H3 |
| InChIKey | WYEUCIMULDGTPA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine?
The IUPAC name of 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine (CID 58242650) is 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine.
What is the SMILES notation for 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine?
The canonical SMILES for 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine is COc1cccc(-c2ccc(Cc3cc(C)ccc3C)s2)n1.
What is the InChIKey of 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine?
The InChIKey is WYEUCIMULDGTPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NOS/c1-13-7-8-14(2)15(11-13)12-16-9-10-18(22-16)17-5-4-6-19(20-17)21-3/h4-11H,12H2,1-3H3.
What are the key properties of 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine?
2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine has a molecular weight of 309.43 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]-6-methoxypyridine is sourced from PubChem (CID 58242650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).