C12H28O2Si2 — CID 58242723
dimethyl-[2-(oxiran-2-ylmethoxy)ethyl]-(2-trimethylsilylethyl)silane (PubChem CID 58242723) has the molecular formula C12H28O2Si2 and a molecular weight of 260.53 g/mol. Its IUPAC name is dimethyl-[2-(oxiran-2-ylmethoxy)ethyl]-(2-trimethylsilylethyl)silane.
| Compound Name | dimethyl-[2-(oxiran-2-ylmethoxy)ethyl]-(2-trimethylsilylethyl)silane |
|---|---|
| PubChem CID | 58242723 |
| Molecular Formula | C12H28O2Si2 |
| Molecular Weight | 260.53 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | dimethyl-[2-(oxiran-2-ylmethoxy)ethyl]-(2-trimethylsilylethyl)silane |
| SMILES | C[Si](C)(C)CC[Si](C)(C)CCOCC1CO1 |
| InChI | InChI=1S/C12H28O2Si2/c1-15(2,3)8-9-16(4,5)7-6-13-10-12-11-14-12/h12H,6-11H2,1-5H3 |
| InChIKey | RUPBATBDYWTASJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|