C13H17F5N2O2 — CID 58242749
ethyl 2-[5-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]acetate (PubChem CID 58242749) has the molecular formula C13H17F5N2O2 and a molecular weight of 328.28 g/mol. Its IUPAC name is ethyl 2-[5-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[5-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 58242749 |
| Molecular Formula | C13H17F5N2O2 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethyl 2-[5-tert-butyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C(F)(F)C(F)(F)F)cc1C(C)(C)C |
| InChI | InChI=1S/C13H17F5N2O2/c1-5-22-10(21)7-20-9(11(2,3)4)6-8(19-20)12(14,15)13(16,17)18/h6H,5,7H2,1-4H3 |
| InChIKey | FGHAZGJFGSYVBU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|