C23H25FN4O3S — CID 58242833
N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 58242833) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 58242833 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NC[C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C23H25FN4O3S/c1-14-22(15(2)31-27-14)32(29,30)26-13-18-5-4-17-10-21-16(11-23(17,18)3)12-25-28(21)20-8-6-19(24)7-9-20/h6-10,12,18,26H,4-5,11,13H2,1-3H3/t18-,23+/m1/s1 |
| InChIKey | YQVIFGFQAVQSMC-JPYJTQIMSA-N |
| XLogP | 3.95 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |