C28H29F4N3O3S — CID 58242843
N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]ethanesulfonamide (PubChem CID 58242843) has the molecular formula C28H29F4N3O3S and a molecular weight of 563.62 g/mol. Its IUPAC name is N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 58242843 |
| Molecular Formula | C28H29F4N3O3S |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]ethanesulfonamide |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@@H]2CN(CCc1ccc(O)cc1)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C28H29F4N3O3S/c1-27-15-20-16-33-35(24-8-6-23(29)7-9-24)26(20)14-21(27)4-5-22(27)17-34(39(37,38)18-28(30,31)32)13-12-19-2-10-25(36)11-3-19/h2-3,6-11,14,16,22,36H,4-5,12-13,15,17-18H2,1H3/t22-,27+/m1/s1 |
| InChIKey | BGAITEZEBSOIRX-AMGIVPHBSA-N |
| XLogP | 5.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |