C32H34FN5O2S — CID 58242850
N-[1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]ethyl]-1-pyridin-3-yl-N-(2-pyridin-2-ylethyl)methanesulfonamide (PubChem CID 58242850) has the molecular formula C32H34FN5O2S and a molecular weight of 571.72 g/mol. Its IUPAC name is N-[1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]ethyl]-1-pyridin-3-yl-N-(2-pyridin-2-ylethyl)methanesulfonamide.
| Compound Name | N-[1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]ethyl]-1-pyridin-3-yl-N-(2-pyridin-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 58242850 |
| Molecular Formula | C32H34FN5O2S |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | N-[1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]ethyl]-1-pyridin-3-yl-N-(2-pyridin-2-ylethyl)methanesulfonamide |
| SMILES | CC([C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C)N(CCc1ccccn1)S(=O)(=O)Cc1cccnc1 |
| InChI | InChI=1S/C32H34FN5O2S/c1-23(37(17-14-28-7-3-4-16-35-28)41(39,40)22-24-6-5-15-34-20-24)30-13-8-26-18-31-25(19-32(26,30)2)21-36-38(31)29-11-9-27(33)10-12-29/h3-7,9-12,15-16,18,20-21,23,30H,8,13-14,17,19,22H2,1-2H3/t23?,30-,32+/m1/s1 |
| InChIKey | RIWHDBWFVILDEH-AWUDQKARSA-N |
| XLogP | 5.62 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |