C21H24F3N5O — CID 58243531
5-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-1-methyl-4,5,6,7-tetrahydroindazole (PubChem CID 58243531) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is 5-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-1-methyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 5-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-1-methyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 58243531 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 5-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-1-methyl-4,5,6,7-tetrahydroindazole |
| SMILES | CCn1c(C2CCc3c(cnn3C)C2)nnc1C(C)(C)Oc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C21H24F3N5O/c1-5-29-19(12-6-7-17-13(8-12)11-25-28(17)4)26-27-20(29)21(2,3)30-18-15(23)9-14(22)10-16(18)24/h9-12H,5-8H2,1-4H3 |
| InChIKey | BUCMUUHWGLMFEU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |