C21H23NO3 — CID 58243705
2-[(4-methoxyphenyl)methyl]-5-(3-methylbutanoyl)-3H-isoindol-1-one (PubChem CID 58243705) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-5-(3-methylbutanoyl)-3H-isoindol-1-one.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-5-(3-methylbutanoyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 58243705 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-5-(3-methylbutanoyl)-3H-isoindol-1-one |
| SMILES | COc1ccc(CN2Cc3cc(C(=O)CC(C)C)ccc3C2=O)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-14(2)10-20(23)16-6-9-19-17(11-16)13-22(21(19)24)12-15-4-7-18(25-3)8-5-15/h4-9,11,14H,10,12-13H2,1-3H3 |
| InChIKey | IFBMKWMNCIGRKB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |