C21H22F3N5O — CID 58243903
5-[4-cyclopropyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 58243903) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 5-[4-cyclopropyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | 5-[4-cyclopropyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 58243903 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 5-[4-cyclopropyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | CC(C)(Oc1c(F)cc(F)cc1F)c1nnc(C2CCc3[nH]ncc3C2)n1C1CC1 |
| InChI | InChI=1S/C21H22F3N5O/c1-21(2,30-18-15(23)8-13(22)9-16(18)24)20-28-27-19(29(20)14-4-5-14)11-3-6-17-12(7-11)10-25-26-17/h8-11,14H,3-7H2,1-2H3,(H,25,26) |
| InChIKey | IXWZMYCQKRZWKC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |