C28H25Cl3O5 — CID 58244465
6-chloro-7-[4-[6-(2,4-dichlorophenyl)hexanoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 58244465) has the molecular formula C28H25Cl3O5 and a molecular weight of 547.86 g/mol. Its IUPAC name is 6-chloro-7-[4-[6-(2,4-dichlorophenyl)hexanoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid.
| Compound Name | 6-chloro-7-[4-[6-(2,4-dichlorophenyl)hexanoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
|---|---|
| PubChem CID | 58244465 |
| Molecular Formula | C28H25Cl3O5 |
| Molecular Weight | 547.86 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 6-chloro-7-[4-[6-(2,4-dichlorophenyl)hexanoyl]phenoxy]-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | O=C(CCCCCc1ccc(Cl)cc1Cl)c1ccc(Oc2cc3c(cc2Cl)C(C(=O)O)CCO3)cc1 |
| InChI | InChI=1S/C28H25Cl3O5/c29-19-9-6-17(23(30)14-19)4-2-1-3-5-25(32)18-7-10-20(11-8-18)36-27-16-26-22(15-24(27)31)21(28(33)34)12-13-35-26/h6-11,14-16,21H,1-5,12-13H2,(H,33,34) |
| InChIKey | HLSWLPBFYYJPHQ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.86 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|