C23H18F3NO3S — CID 58244751
9-[4-(trifluoromethyl)phenyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 58244751) has the molecular formula C23H18F3NO3S and a molecular weight of 445.46 g/mol. Its IUPAC name is 9-[4-(trifluoromethyl)phenyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | 9-[4-(trifluoromethyl)phenyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 58244751 |
| Molecular Formula | C23H18F3NO3S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 9-[4-(trifluoromethyl)phenyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | O=C1C(=O)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2C2=C1SCC1(CCNCC1)O2 |
| InChI | InChI=1S/C23H18F3NO3S/c24-23(25,26)15-4-1-13(2-5-15)14-3-6-16-17(11-14)20-21(19(29)18(16)28)31-12-22(30-20)7-9-27-10-8-22/h1-6,11,27H,7-10,12H2 |
| InChIKey | KGGQJLRLLMUJHD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|