C37H49N3O5 — CID 58244858
tert-butyl (8S,10R)-19-cyclohexyl-5-methoxy-10-[methyl-[2-[2-(methylamino)ethoxy]ethyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylate (PubChem CID 58244858) has the molecular formula C37H49N3O5 and a molecular weight of 615.82 g/mol. Its IUPAC name is tert-butyl (8S,10R)-19-cyclohexyl-5-methoxy-10-[methyl-[2-[2-(methylamino)ethoxy]ethyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylate.
| Compound Name | tert-butyl (8S,10R)-19-cyclohexyl-5-methoxy-10-[methyl-[2-[2-(methylamino)ethoxy]ethyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 58244858 |
| Molecular Formula | C37H49N3O5 |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.37 |
| IUPAC Name | tert-butyl (8S,10R)-19-cyclohexyl-5-methoxy-10-[methyl-[2-[2-(methylamino)ethoxy]ethyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylate |
| SMILES | CNCCOCCN(C)C(=O)[C@]12C[C@H]1c1cc(OC)ccc1-c1c(C3CCCCC3)c3ccc(C(=O)OC(C)(C)C)cc3n1C2 |
| InChI | InChI=1S/C37H49N3O5/c1-36(2,3)45-34(41)25-12-14-28-31(20-25)40-23-37(35(42)39(5)17-19-44-18-16-38-4)22-30(37)29-21-26(43-6)13-15-27(29)33(40)32(28)24-10-8-7-9-11-24/h12-15,20-21,24,30,38H,7-11,16-19,22-23H2,1-6H3/t30-,37-/m0/s1 |
| InChIKey | ISQMKSSXGDTBBS-WLFXDIPCSA-N |
| XLogP | 6.50 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|