C32H37N3O6S — CID 58244868
methyl 19-cyclohexyl-5-methoxy-15-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate (PubChem CID 58244868) has the molecular formula C32H37N3O6S and a molecular weight of 591.73 g/mol. Its IUPAC name is methyl 19-cyclohexyl-5-methoxy-15-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate.
| Compound Name | methyl 19-cyclohexyl-5-methoxy-15-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate |
|---|---|
| PubChem CID | 58244868 |
| Molecular Formula | C32H37N3O6S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | methyl 19-cyclohexyl-5-methoxy-15-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate |
| SMILES | C=CCN(C)S(=O)(=O)NC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC1(C(=O)OC)CC1c1cc(OC)ccc1-3 |
| InChI | InChI=1S/C32H37N3O6S/c1-5-15-34(2)42(38,39)33-30(36)21-11-13-24-27(16-21)35-19-32(31(37)41-4)18-26(32)25-17-22(40-3)12-14-23(25)29(35)28(24)20-9-7-6-8-10-20/h5,11-14,16-17,20,26H,1,6-10,15,18-19H2,2-4H3,(H,33,36) |
| InChIKey | UXLIOGDZGPZQKG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|