About (E)-N,N-di(ethyl)but-2-enamide;yttrium
(E)-N,N-di(ethyl)but-2-enamide;yttrium (PubChem CID 58244894) has the molecular formula C8H13NOY-2
and a molecular weight of 228.10 g/mol. Its IUPAC name is (E)-N,N-di(ethyl)but-2-enamide;yttrium.
Molecular Properties
| Compound Name | (E)-N,N-di(ethyl)but-2-enamide;yttrium |
| PubChem CID | 58244894 |
| Molecular Formula | C8H13NOY-2 |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (E)-N,N-di(ethyl)but-2-enamide;yttrium |
| SMILES | [CH2-]CN(C[CH2-])C(=O)/C=C/C.[Y] |
| InChI | InChI=1S/C8H13NO.Y/c1-4-7-8(10)9(5-2)6-3;/h4,7H,2-3,5-6H2,1H3;/q-2;/b7-4+; |
| InChIKey | CPZDTLRLXIXPEV-KQGICBIGSA-N |
| XLogP | 1.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-di(ethyl)but-2-enamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-di(ethyl)but-2-enamide;yttrium?
The IUPAC name of (E)-N,N-di(ethyl)but-2-enamide;yttrium (CID 58244894) is (E)-N,N-di(ethyl)but-2-enamide;yttrium.
What is the SMILES notation for (E)-N,N-di(ethyl)but-2-enamide;yttrium?
The canonical SMILES for (E)-N,N-di(ethyl)but-2-enamide;yttrium is [CH2-]CN(C[CH2-])C(=O)/C=C/C.[Y].
What is the InChIKey of (E)-N,N-di(ethyl)but-2-enamide;yttrium?
The InChIKey is CPZDTLRLXIXPEV-KQGICBIGSA-N. The full InChI is InChI=1S/C8H13NO.Y/c1-4-7-8(10)9(5-2)6-3;/h4,7H,2-3,5-6H2,1H3;/q-2;/b7-4+;.
What are the key properties of (E)-N,N-di(ethyl)but-2-enamide;yttrium?
(E)-N,N-di(ethyl)but-2-enamide;yttrium has a molecular weight of 228.10 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-di(ethyl)but-2-enamide;yttrium is sourced from PubChem (CID 58244894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).