C13H20N6O2 — CID 58244996
7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 58244996) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 58244996 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 7-tert-butyl-3,9-dimethyl-1,4,5a,9a-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1=NNC2=NC3C(C(=O)N(C(C)(C)C)C(=O)N3C)N2C1 |
| InChI | InChI=1S/C13H20N6O2/c1-7-6-18-8-9(14-11(18)16-15-7)17(5)12(21)19(10(8)20)13(2,3)4/h8-9H,6H2,1-5H3,(H,14,16) |
| InChIKey | LWEXZIWXBXZVGX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |