About 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane
9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane (PubChem CID 58245057) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane |
| PubChem CID | 58245057 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)N1CCCC2(C1)NCCS2 |
| InChI | InChI=1S/C11H22N2S/c1-10(2,3)13-7-4-5-11(9-13)12-6-8-14-11/h12H,4-9H2,1-3H3 |
| InChIKey | BBUNPELNHSHKIQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane?
The IUPAC name of 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane (CID 58245057) is 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane.
What is the SMILES notation for 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane?
The canonical SMILES for 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane is CC(C)(C)N1CCCC2(C1)NCCS2.
What is the InChIKey of 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane?
The InChIKey is BBUNPELNHSHKIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-10(2,3)13-7-4-5-11(9-13)12-6-8-14-11/h12H,4-9H2,1-3H3.
What are the key properties of 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane?
9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane has a molecular weight of 214.38 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-tert-butyl-1-thia-4,9-diazaspiro[4.5]decane is sourced from PubChem (CID 58245057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).