About 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one
4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one (PubChem CID 58245127) has the molecular formula C15H28N2OS
and a molecular weight of 284.47 g/mol. Its IUPAC name is 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one |
| PubChem CID | 58245127 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one |
| SMILES | CC(C)(C)N1CCC2(CC1)SC(=O)CN2C(C)(C)C |
| InChI | InChI=1S/C15H28N2OS/c1-13(2,3)16-9-7-15(8-10-16)17(14(4,5)6)11-12(18)19-15/h7-11H2,1-6H3 |
| InChIKey | DXMRRDDJHHQZAD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one?
The IUPAC name of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one (CID 58245127) is 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one.
What is the SMILES notation for 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one?
The canonical SMILES for 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one is CC(C)(C)N1CCC2(CC1)SC(=O)CN2C(C)(C)C.
What is the InChIKey of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one?
The InChIKey is DXMRRDDJHHQZAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2OS/c1-13(2,3)16-9-7-15(8-10-16)17(14(4,5)6)11-12(18)19-15/h7-11H2,1-6H3.
What are the key properties of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one?
4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one has a molecular weight of 284.47 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decan-2-one is sourced from PubChem (CID 58245127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).