About 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane
4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 58245234) has the molecular formula C15H30N2S
and a molecular weight of 270.49 g/mol. Its IUPAC name is 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 58245234 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)N1CCC2(CC1)SCCN2C(C)(C)C |
| InChI | InChI=1S/C15H30N2S/c1-13(2,3)16-9-7-15(8-10-16)17(11-12-18-15)14(4,5)6/h7-12H2,1-6H3 |
| InChIKey | LRVABKCAGRHKDR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane (CID 58245234) is 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane is CC(C)(C)N1CCC2(CC1)SCCN2C(C)(C)C.
What is the InChIKey of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is LRVABKCAGRHKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2S/c1-13(2,3)16-9-7-15(8-10-16)17(11-12-18-15)14(4,5)6/h7-12H2,1-6H3.
What are the key properties of 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane?
4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 270.49 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-ditert-butyl-1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 58245234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).