About 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one
5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one (PubChem CID 58245517) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one.
Molecular Properties
| Compound Name | 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one |
| PubChem CID | 58245517 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one |
| SMILES | CCN1C(=O)CCOC12CCNCC2 |
| InChI | InChI=1S/C10H18N2O2/c1-2-12-9(13)3-8-14-10(12)4-6-11-7-5-10/h11H,2-8H2,1H3 |
| InChIKey | RNDJKXVOXKGBSF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one?
The IUPAC name of 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one (CID 58245517) is 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one.
What is the SMILES notation for 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one?
The canonical SMILES for 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one is CCN1C(=O)CCOC12CCNCC2.
What is the InChIKey of 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one?
The InChIKey is RNDJKXVOXKGBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-2-12-9(13)3-8-14-10(12)4-6-11-7-5-10/h11H,2-8H2,1H3.
What are the key properties of 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one?
5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one has a molecular weight of 198.27 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-oxa-5,9-diazaspiro[5.5]undecan-4-one is sourced from PubChem (CID 58245517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).