C11H10FNS — CID 58245751
5-(3-fluorophenyl)-2,4-dimethyl-1,3-thiazole (PubChem CID 58245751) has the molecular formula C11H10FNS and a molecular weight of 207.27 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2,4-dimethyl-1,3-thiazole.
| Compound Name | 5-(3-fluorophenyl)-2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 58245751 |
| Molecular Formula | C11H10FNS |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(3-fluorophenyl)-2,4-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(C)c(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C11H10FNS/c1-7-11(14-8(2)13-7)9-4-3-5-10(12)6-9/h3-6H,1-2H3 |
| InChIKey | DIBDGWWGZMFLRS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |