C32H38N4O2S — CID 58246482
3-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione (PubChem CID 58246482) has the molecular formula C32H38N4O2S and a molecular weight of 542.75 g/mol. Its IUPAC name is 3-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 58246482 |
| Molecular Formula | C32H38N4O2S |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 3-[2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(C4CCN(CCn5c(=O)[nH]c6ccccc6c5=O)CC4)n3)ccc21 |
| InChI | InChI=1S/C32H38N4O2S/c1-31(2)13-14-32(3,4)25-19-22(9-10-24(25)31)27-20-39-28(33-27)21-11-15-35(16-12-21)17-18-36-29(37)23-7-5-6-8-26(23)34-30(36)38/h5-10,19-21H,11-18H2,1-4H3,(H,34,38) |
| InChIKey | FWOVXYGQPKEHPE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |