C30H43FN2O4 — CID 58246586
3-[(2R)-2-(aminomethyl)-3-cyclohexylpropyl]-4-[3-[(2-fluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 58246586) has the molecular formula C30H43FN2O4 and a molecular weight of 514.68 g/mol. Its IUPAC name is 3-[(2R)-2-(aminomethyl)-3-cyclohexylpropyl]-4-[3-[(2-fluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2R)-2-(aminomethyl)-3-cyclohexylpropyl]-4-[3-[(2-fluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 58246586 |
| Molecular Formula | C30H43FN2O4 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 3-[(2R)-2-(aminomethyl)-3-cyclohexylpropyl]-4-[3-[(2-fluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | COCCCOC(c1ccccc1F)C1CCCN(c2c(C[C@H](CN)CC3CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C30H43FN2O4/c1-36-15-8-16-37-30(24-12-5-6-13-26(24)31)23-11-7-14-33(20-23)27-25(28(34)29(27)35)18-22(19-32)17-21-9-3-2-4-10-21/h5-6,12-13,21-23,30H,2-4,7-11,14-20,32H2,1H3/t22-,23?,30?/m1/s1 |
| InChIKey | QOVLIVOIUMBOMY-BIWSUBDXSA-N |
| XLogP | 4.52 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|