About [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate
[(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate (PubChem CID 58246593) has the molecular formula C9H20O4S
and a molecular weight of 224.32 g/mol. Its IUPAC name is [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate.
Molecular Properties
| Compound Name | [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate |
| PubChem CID | 58246593 |
| Molecular Formula | C9H20O4S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate |
| SMILES | COC(C)(C)C[C@H](C)COS(C)(=O)=O |
| InChI | InChI=1S/C9H20O4S/c1-8(6-9(2,3)12-4)7-13-14(5,10)11/h8H,6-7H2,1-5H3/t8-/m0/s1 |
| InChIKey | LWPSBAORXJJZRP-QMMMGPOBSA-N |
| XLogP | 1.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate?
The IUPAC name of [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate (CID 58246593) is [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate.
What is the SMILES notation for [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate?
The canonical SMILES for [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate is COC(C)(C)C[C@H](C)COS(C)(=O)=O.
What is the InChIKey of [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate?
The InChIKey is LWPSBAORXJJZRP-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H20O4S/c1-8(6-9(2,3)12-4)7-13-14(5,10)11/h8H,6-7H2,1-5H3/t8-/m0/s1.
What are the key properties of [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate?
[(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate has a molecular weight of 224.32 g/mol, XLogP of 1.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-methoxy-2,4-dimethylpentyl] methanesulfonate is sourced from PubChem (CID 58246593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).