C17H25ClFNO — CID 58246964
(1S)-1-(3-chloro-2-fluorophenyl)-1-[(3R)-piperidin-3-yl]hexan-1-ol (PubChem CID 58246964) has the molecular formula C17H25ClFNO and a molecular weight of 313.84 g/mol. Its IUPAC name is (1S)-1-(3-chloro-2-fluorophenyl)-1-[(3R)-piperidin-3-yl]hexan-1-ol.
| Compound Name | (1S)-1-(3-chloro-2-fluorophenyl)-1-[(3R)-piperidin-3-yl]hexan-1-ol |
|---|---|
| PubChem CID | 58246964 |
| Molecular Formula | C17H25ClFNO |
| Molecular Weight | 313.84 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (1S)-1-(3-chloro-2-fluorophenyl)-1-[(3R)-piperidin-3-yl]hexan-1-ol |
| SMILES | CCCCC[C@@](O)(c1cccc(Cl)c1F)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C17H25ClFNO/c1-2-3-4-10-17(21,13-7-6-11-20-12-13)14-8-5-9-15(18)16(14)19/h5,8-9,13,20-21H,2-4,6-7,10-12H2,1H3/t13-,17+/m1/s1 |
| InChIKey | PMYJWTGMRURAKU-DYVFJYSZSA-N |
| XLogP | 4.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|