C17H18N6 — CID 58247198
2-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N,5-dimethyl-1,2,4-triazol-3-amine (PubChem CID 58247198) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N,5-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 2-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N,5-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 58247198 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-N,5-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nc(C)nn1-c1cc2c(nn1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C17H18N6/c1-11-19-17(18-2)23(22-11)15-10-13-8-5-7-12-6-3-4-9-14(12)16(13)21-20-15/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,18,19,22) |
| InChIKey | JLLBPDORQOHCCI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |