C27H31N3O5 — CID 58247325
(1R,19S)-14-hydroxy-9,9,16,16-tetramethyl-2-(trideuteriomethoxy)-8-oxa-14,23,25-triazaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-3(15),4(13),5,7(12),10-pentaene-24,26-dione (PubChem CID 58247325) has the molecular formula C27H31N3O5 and a molecular weight of 480.58 g/mol. Its IUPAC name is (1R,19S)-14-hydroxy-9,9,16,16-tetramethyl-2-(trideuteriomethoxy)-8-oxa-14,23,25-triazaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-3(15),4(13),5,7(12),10-pentaene-24,26-dione.
| Compound Name | (1R,19S)-14-hydroxy-9,9,16,16-tetramethyl-2-(trideuteriomethoxy)-8-oxa-14,23,25-triazaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-3(15),4(13),5,7(12),10-pentaene-24,26-dione |
|---|---|
| PubChem CID | 58247325 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (1R,19S)-14-hydroxy-9,9,16,16-tetramethyl-2-(trideuteriomethoxy)-8-oxa-14,23,25-triazaheptacyclo[17.5.2.01,17.03,15.04,13.07,12.019,23]hexacosa-3(15),4(13),5,7(12),10-pentaene-24,26-dione |
| SMILES | [2H]C([2H])([2H])OC1c2c(n(O)c3c4c(ccc23)OC(C)(C)C=C4)C(C)(C)C2C[C@]34CCCN3C(=O)[C@]12NC4=O |
| InChI | InChI=1S/C27H31N3O5/c1-24(2)11-9-14-16(35-24)8-7-15-18-20(30(33)19(14)15)25(3,4)17-13-26-10-6-12-29(26)23(32)27(17,21(18)34-5)28-22(26)31/h7-9,11,17,21,33H,6,10,12-13H2,1-5H3,(H,28,31)/t17?,21?,26-,27+/m0/s1/i5D3 |
| InChIKey | MLDRFVIRZQYMDK-CZFLZQABSA-N |
| XLogP | 3.29 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|