C24H33N3O2Si — CID 58247469
[(3R,4S,5R)-4-azido-5-[(2S)-butan-2-yl]oxolan-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 58247469) has the molecular formula C24H33N3O2Si and a molecular weight of 423.63 g/mol. Its IUPAC name is [(3R,4S,5R)-4-azido-5-[(2S)-butan-2-yl]oxolan-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(3R,4S,5R)-4-azido-5-[(2S)-butan-2-yl]oxolan-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 58247469 |
| Molecular Formula | C24H33N3O2Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | [(3R,4S,5R)-4-azido-5-[(2S)-butan-2-yl]oxolan-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC[C@H](C)[C@H]1OC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C24H33N3O2Si/c1-6-18(2)23-22(26-27-25)21(17-28-23)29-30(24(3,4)5,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23H,6,17H2,1-5H3/t18-,21-,22+,23+/m0/s1 |
| InChIKey | ZKFVARSRZNPYEL-XSEFMFLKSA-N |
| XLogP | 5.06 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|