About 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine
5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 58247675) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine.
Molecular Properties
| Compound Name | 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine |
| PubChem CID | 58247675 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | CCC1C=NCCC1C |
| InChI | InChI=1S/C8H15N/c1-3-8-6-9-5-4-7(8)2/h6-8H,3-5H2,1-2H3 |
| InChIKey | YIOZEVKAZPNYHK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine?
The IUPAC name of 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine (CID 58247675) is 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine is CCC1C=NCCC1C.
What is the InChIKey of 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine?
The InChIKey is YIOZEVKAZPNYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-3-8-6-9-5-4-7(8)2/h6-8H,3-5H2,1-2H3.
What are the key properties of 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine?
5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine has a molecular weight of 125.21 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-methyl-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 58247675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).