About 1-diazo-3-methylurea
1-diazo-3-methylurea (PubChem CID 58247683) has the molecular formula C2H4N4O
and a molecular weight of 100.08 g/mol. Its IUPAC name is 1-diazo-3-methylurea.
Molecular Properties
| Compound Name | 1-diazo-3-methylurea |
| PubChem CID | 58247683 |
| Molecular Formula | C2H4N4O |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | 1-diazo-3-methylurea |
| SMILES | CNC(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C2H4N4O/c1-4-2(7)5-6-3/h1H3,(H,4,7) |
| InChIKey | LTALUESYDXFPNL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-3-methylurea?
The IUPAC name of 1-diazo-3-methylurea (CID 58247683) is 1-diazo-3-methylurea.
What is the SMILES notation for 1-diazo-3-methylurea?
The canonical SMILES for 1-diazo-3-methylurea is CNC(=O)N=[N+]=[N-].
What is the InChIKey of 1-diazo-3-methylurea?
The InChIKey is LTALUESYDXFPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4O/c1-4-2(7)5-6-3/h1H3,(H,4,7).
What are the key properties of 1-diazo-3-methylurea?
1-diazo-3-methylurea has a molecular weight of 100.08 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-3-methylurea is sourced from PubChem (CID 58247683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).