About tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate
tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate (PubChem CID 58247994) has the molecular formula C14H18BrNO2
and a molecular weight of 312.21 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate |
| PubChem CID | 58247994 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H18BrNO2/c1-14(2,3)18-13(17)16-12-7-4-9-8-10(15)5-6-11(9)12/h5-6,8,12H,4,7H2,1-3H3,(H,16,17) |
| InChIKey | LFSNVJDYBBIPHH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate?
The IUPAC name of tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate (CID 58247994) is tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate.
What is the SMILES notation for tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate?
The canonical SMILES for tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate is CC(C)(C)OC(=O)NC1CCc2cc(Br)ccc21.
What is the InChIKey of tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate?
The InChIKey is LFSNVJDYBBIPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrNO2/c1-14(2,3)18-13(17)16-12-7-4-9-8-10(15)5-6-11(9)12/h5-6,8,12H,4,7H2,1-3H3,(H,16,17).
What are the key properties of tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate?
tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate has a molecular weight of 312.21 g/mol, XLogP of 3.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(5-bromo-2,3-dihydro-1H-inden-1-yl)carbamate is sourced from PubChem (CID 58247994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).