C27H30F3NO3 — CID 58248001
tert-butyl N-[5-[(E)-6,6,6-trifluoro-5-(3-methylphenyl)-3-oxohex-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 58248001) has the molecular formula C27H30F3NO3 and a molecular weight of 473.54 g/mol. Its IUPAC name is tert-butyl N-[5-[(E)-6,6,6-trifluoro-5-(3-methylphenyl)-3-oxohex-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(E)-6,6,6-trifluoro-5-(3-methylphenyl)-3-oxohex-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 58248001 |
| Molecular Formula | C27H30F3NO3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | tert-butyl N-[5-[(E)-6,6,6-trifluoro-5-(3-methylphenyl)-3-oxohex-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | Cc1cccc(C(CC(=O)/C=C/c2ccc3c(c2)CCC3NC(=O)OC(C)(C)C)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H30F3NO3/c1-17-6-5-7-20(14-17)23(27(28,29)30)16-21(32)11-8-18-9-12-22-19(15-18)10-13-24(22)31-25(33)34-26(2,3)4/h5-9,11-12,14-15,23-24H,10,13,16H2,1-4H3,(H,31,33)/b11-8+ |
| InChIKey | KXQIFXQVQMIAKQ-DHZHZOJOSA-N |
| XLogP | 6.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|