C18H18N2O2 — CID 58248297
1',3',6-trimethylspiro[1,3-dihydrocyclopenta[b]naphthalene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 58248297) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1',3',6-trimethylspiro[1,3-dihydrocyclopenta[b]naphthalene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1',3',6-trimethylspiro[1,3-dihydrocyclopenta[b]naphthalene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 58248297 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1',3',6-trimethylspiro[1,3-dihydrocyclopenta[b]naphthalene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc2cc3c(cc2c1)CC1(C3)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C18H18N2O2/c1-11-4-5-12-7-14-9-18(10-15(14)8-13(12)6-11)16(21)19(2)17(22)20(18)3/h4-8H,9-10H2,1-3H3 |
| InChIKey | FBFXLTIOLFQRBM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|