C24H27FN2O3 — CID 58248668
9-[1-[(4-fluorophenyl)methyl]indol-2-yl]-N-hydroxy-8-oxononanamide (PubChem CID 58248668) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 9-[1-[(4-fluorophenyl)methyl]indol-2-yl]-N-hydroxy-8-oxononanamide.
| Compound Name | 9-[1-[(4-fluorophenyl)methyl]indol-2-yl]-N-hydroxy-8-oxononanamide |
|---|---|
| PubChem CID | 58248668 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 9-[1-[(4-fluorophenyl)methyl]indol-2-yl]-N-hydroxy-8-oxononanamide |
| SMILES | O=C(CCCCCCC(=O)NO)Cc1cc2ccccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN2O3/c25-20-13-11-18(12-14-20)17-27-21(15-19-7-5-6-9-23(19)27)16-22(28)8-3-1-2-4-10-24(29)26-30/h5-7,9,11-15,30H,1-4,8,10,16-17H2,(H,26,29) |
| InChIKey | RVDPSBAFDJVLRO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|